Products 827034-42-4
CAS 827034-42-4 is the registry number for Jun15716. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-ditert-butyl-N-[2-(dimethylamino)ethyl]benzamide (CAS 827034-42-4) is a chemical compound with the molecular formula C19H32N2O and a molecular weight of 304.5 g/mol. IUPAC name: 3,5-ditert-butyl-N-[2-(dimethylamino)ethyl]benzamide. InChIKey: BZWUYLMBJJQZMS-UHFFFAOYSA-N.
| Molecular formula | C19H32N2O |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | 3,5-ditert-butyl-N-[2-(dimethylamino)ethyl]benzamide |
| InChIKey | BZWUYLMBJJQZMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)NCCN(C)C)C(C)(C)C |
Computed by PubChem (NCBI)