Products 827325-60-0

CAS 827325-60-0 is the registry number for 2-[(3-Bromobenzoyl)amino]-4-chlorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(3-bromobenzoyl)amino]-4-chlorobenzoic acid (CAS 827325-60-0) is a chemical compound with the molecular formula C14H9BrClNO3 and a molecular weight of 354.58 g/mol. IUPAC name: 2-[(3-bromobenzoyl)amino]-4-chlorobenzoic acid. InChIKey: NKUSVNRZDILGSG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9BrClNO3
Molecular weight354.58 g/mol
IUPAC name2-[(3-bromobenzoyl)amino]-4-chlorobenzoic acid
InChIKeyNKUSVNRZDILGSG-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Br)C(=O)NC2=C(C=CC(=C2)Cl)C(=O)O

Computed by PubChem (NCBI)