CAS 827614-25-5 appears in our catalog under these names: 6-(4-Bromophenyl)-4-chlorothieno(3,2-d)pyrimidine, 6-(4-Bromophenyl)-4-chloro-thieno[3,2-d]pyrimidine, 97%. Offered by: Biosynth, Fluorochem. Available pack sizes: 100mg, 1g, 50mg, 250mg.
6-(4-bromophenyl)-4-chlorothieno[3,2-d]pyrimidine (CAS 827614-25-5) is a chemical compound with the molecular formula C12H6BrClN2S and a molecular weight of 325.61 g/mol. IUPAC name: 6-(4-bromophenyl)-4-chlorothieno[3,2-d]pyrimidine. InChIKey: CQIBGLMUMFTNSI-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClN2S |
|---|---|
| Molecular weight | 325.61 g/mol |
| IUPAC name | 6-(4-bromophenyl)-4-chlorothieno[3,2-d]pyrimidine |
| InChIKey | CQIBGLMUMFTNSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(S2)C(=NC=N3)Cl)Br |
Computed by PubChem (NCBI)