CAS 82767-90-6 appears in our catalog under these names: Anthracene 9,10-dipropionate Disodium Salt, Anthracene–9,10–dipropionic acid disodium salt, Anthracene-9,10-dipropionic acid disodium salt, Sodium 3,3'-(anthracene-9,10-diyl)dipropanoate 98%, Sodium 3,3'-(anthracene-9,10-diyl)dipropanoate, 98%, 98%. Offered by: TRC, GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 250mg, 10mg, 100mg, 25mg, 50mg, 1g.
Disodium;3-[10-(2-carboxylatoethyl)anthracen-9-yl]propanoate (CAS 82767-90-6) is a chemical compound with the molecular formula C20H16Na2O4 and a molecular weight of 366.3 g/mol. IUPAC name: disodium;3-[10-(2-carboxylatoethyl)anthracen-9-yl]propanoate. InChIKey: HYTWSZKAHPYXCU-UHFFFAOYSA-L.
| Molecular formula | C20H16Na2O4 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | disodium;3-[10-(2-carboxylatoethyl)anthracen-9-yl]propanoate |
| InChIKey | HYTWSZKAHPYXCU-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2CCC(=O)[O-])CCC(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)