CAS 82799-91-5 is the registry number for (2,2'–bipyridine)–5,5'–dicarbonyl dichloride. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 500mg.
6-(5-carbonochloridoyl-2-pyridinyl)pyridine-3-carbonyl chloride (CAS 82799-91-5) is a chemical compound with the molecular formula C12H6Cl2N2O2 and a molecular weight of 281.09 g/mol. IUPAC name: 6-(5-carbonochloridoyl-2-pyridinyl)pyridine-3-carbonyl chloride. InChIKey: PVUKYKDJKZKUCM-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2O2 |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 6-(5-carbonochloridoyl-2-pyridinyl)pyridine-3-carbonyl chloride |
| InChIKey | PVUKYKDJKZKUCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)Cl)C2=NC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)