CAS 82822-26-2 is the registry number for (Perfluoroheptanoyl)acetone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecane-2,4-dione (CAS 82822-26-2) is a chemical compound with the molecular formula C10H5F13O2 and a molecular weight of 404.12 g/mol. IUPAC name: 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecane-2,4-dione. InChIKey: VMRLNPHYYNLINM-UHFFFAOYSA-N.
| Molecular formula | C10H5F13O2 |
|---|---|
| Molecular weight | 404.12 g/mol |
| IUPAC name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecane-2,4-dione |
| InChIKey | VMRLNPHYYNLINM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)