CAS 82829-43-4 appears in our catalog under these names: Sodium 4-((2-ethylhexyl)oxy)-4-oxo-3-sulfobutanoate, 4-((2-Ethylhexyl)oxy)-4-oxo-3-sulfobutanoic acid (sodium), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium 4-(2-ethylhexoxy)-4-oxo-3-sulfobutanoate (CAS 82829-43-4) is a chemical compound with the molecular formula C12H21NaO7S and a molecular weight of 332.35 g/mol. IUPAC name: sodium 4-(2-ethylhexoxy)-4-oxo-3-sulfobutanoate. InChIKey: ZNOZEKFDBJRBMI-UHFFFAOYSA-M.
| Molecular formula | C12H21NaO7S |
|---|---|
| Molecular weight | 332.35 g/mol |
| IUPAC name | sodium 4-(2-ethylhexoxy)-4-oxo-3-sulfobutanoate |
| InChIKey | ZNOZEKFDBJRBMI-UHFFFAOYSA-M |
| SMILES | CCCCC(CC)COC(=O)C(CC(=O)[O-])S(=O)(=O)O.[Na+] |
Computed by PubChem (NCBI)