CAS 82855-62-7 appears in our catalog under these names: Cytarabine Impurity 3, Cytarabine Impurity 13, Cytarabine Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R,3R,4S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-2-yl]methyl acetate (CAS 82855-62-7) is a chemical compound with the molecular formula C17H19N5O8 and a molecular weight of 421.4 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-2-yl]methyl acetate. InChIKey: WLVWKXFSZYCKGR-DMRZNYOFSA-N.
| Molecular formula | C17H19N5O8 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| InChIKey | WLVWKXFSZYCKGR-DMRZNYOFSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H](O1)N2C=CC(=NC2=O)N3C=NC=N3)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)