CAS 82875-49-8 appears in our catalog under these names: Chlortalidone (Chlorthalidone) EP Impurity E, Chlortalidone EP Impurity E, 3-Dehydroxy Chlorthalidone, Chlorthalidone impurity E, DEOXY CHLORTHALIDONE. Offered by: Chemat Brand, TRC, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 10mg, 2mg, 1mg, 5mg, 25mg.
2-chloro-5-(3-oxo-1,2-dihydroisoindol-1-yl)benzenesulfonamide (CAS 82875-49-8) is a chemical compound with the molecular formula C14H11ClN2O3S and a molecular weight of 322.8 g/mol. IUPAC name: 2-chloro-5-(3-oxo-1,2-dihydroisoindol-1-yl)benzenesulfonamide. InChIKey: NPCMXXHTULKTQS-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O3S |
|---|---|
| Molecular weight | 322.8 g/mol |
| IUPAC name | 2-chloro-5-(3-oxo-1,2-dihydroisoindol-1-yl)benzenesulfonamide |
| InChIKey | NPCMXXHTULKTQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(NC2=O)C3=CC(=C(C=C3)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)