CAS 828911-72-4 appears in our catalog under these names: 4,5,7-Trichloro-2,3-dihydro-1h-indole-2,3-dione, 95%, 4,5,7-Trichloro-2,3-dihydro-1H-indole-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4,5,7-trichloro-1H-indole-2,3-dione (CAS 828911-72-4) is a chemical compound with the molecular formula C8H2Cl3NO2 and a molecular weight of 250.5 g/mol. IUPAC name: 4,5,7-trichloro-1H-indole-2,3-dione. InChIKey: OXDJCRSIMJHOQX-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl3NO2 |
|---|---|
| Molecular weight | 250.5 g/mol |
| IUPAC name | 4,5,7-trichloro-1H-indole-2,3-dione |
| InChIKey | OXDJCRSIMJHOQX-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1Cl)Cl)C(=O)C(=O)N2)Cl |
Computed by PubChem (NCBI)