CAS 828934-43-6 is the registry number for S–Etomxir. Offered by: GLPBio. Available pack sizes: 10mg.
Sodium (2S)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate (CAS 828934-43-6) is a chemical compound with the molecular formula C15H18ClNaO4 and a molecular weight of 320.74 g/mol. IUPAC name: sodium (2S)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate. InChIKey: RPACBEVZENYWOL-RSAXXLAASA-M.
| Molecular formula | C15H18ClNaO4 |
|---|---|
| Molecular weight | 320.74 g/mol |
| IUPAC name | sodium (2S)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate |
| InChIKey | RPACBEVZENYWOL-RSAXXLAASA-M |
| SMILES | C1[C@@](O1)(CCCCCCOC2=CC=C(C=C2)Cl)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)