Products 829-26-5
CAS 829-26-5 is the registry number for 2,3,6-Trimethylnaphthalene. Offered by: TRC. Available pack sizes: 1g.
2,3,6-trimethylnaphthalene (CAS 829-26-5) is a chemical compound with the molecular formula C13H14 and a molecular weight of 170.25 g/mol. IUPAC name: 2,3,6-trimethylnaphthalene. InChIKey: UNBZRJCHIWTUHB-UHFFFAOYSA-N.
| Molecular formula | C13H14 |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | 2,3,6-trimethylnaphthalene |
| InChIKey | UNBZRJCHIWTUHB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C(=C2)C)C |
Computed by PubChem (NCBI)
Synonyms:
Naphthalene, 2,3,6-trimethyl-, Naphthalene, 2,3,6trimethyl, Naphthalene, 2,3,6-trimethyl-(8CI), Naphthalene, 2,3,6-trimethyl-(8CI)(9CI), InChI=1/C13H14/c1-9-4-5-12-7-10(2)11(3)8-13(12)6-9/h4-8H,1-3H, UNBZRJCHIWTUHB-UHFFFAOYSA-N, 2,6-Trimethylnaphthalene, Maybridge1_004328, 2,3,6-Trimethylnaphthalin, Naphthalene,3,6-trimethyl-