CAS 82921-86-6 appears in our catalog under these names: 3,8-Dinitro-6-phenyl-phenanthridine, 3,8-DINITRO-6-PHENYL-PHENANTHRIDINE, 98%, Phenanthridine,3,8-dinitro-6-phenyl-, 98%, 98%. Offered by: TRC, Fluorochem, Chemat. Available pack sizes: 1g, 2,5g, 500mg, 20mg, 50mg, 100mg.
3,8-dinitro-6-phenylphenanthridine (CAS 82921-86-6) is a chemical compound with the molecular formula C19H11N3O4 and a molecular weight of 345.3 g/mol. IUPAC name: 3,8-dinitro-6-phenylphenanthridine. InChIKey: FCDIEAMONAJOJE-UHFFFAOYSA-N.
| Molecular formula | C19H11N3O4 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 3,8-dinitro-6-phenylphenanthridine |
| InChIKey | FCDIEAMONAJOJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=C(C=CC3=C4C=CC(=CC4=N2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)