Products 82935-04-4
CAS 82935-04-4 is the registry number for Trimetrexate (isethionate). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxyethanesulfonic acid;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine (CAS 82935-04-4) is a chemical compound with the molecular formula C21H29N5O7S and a molecular weight of 495.6 g/mol. IUPAC name: 2-hydroxyethanesulfonic acid;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine. InChIKey: YATKEMOVGUXIDY-UHFFFAOYSA-N.
| Molecular formula | C21H29N5O7S |
|---|---|
| Molecular weight | 495.6 g/mol |
| IUPAC name | 2-hydroxyethanesulfonic acid;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine |
| InChIKey | YATKEMOVGUXIDY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=NC(=N2)N)N)CNC3=CC(=C(C(=C3)OC)OC)OC.C(CS(=O)(=O)O)O |
Computed by PubChem (NCBI)