CAS 82951-44-8 is the registry number for tert-butyl trifluoromethanesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl trifluoromethanesulfonate (CAS 82951-44-8) is a chemical compound with the molecular formula C5H9F3O3S and a molecular weight of 206.19 g/mol. IUPAC name: tert-butyl trifluoromethanesulfonate. InChIKey: JIEKWWJFWIGHDQ-UHFFFAOYSA-N.
| Molecular formula | C5H9F3O3S |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | tert-butyl trifluoromethanesulfonate |
| InChIKey | JIEKWWJFWIGHDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)