CAS 82956-09-0 is the registry number for Nafamostat Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(6-carbamimidoylnaphthalen-2-yl) 3-(diaminomethylideneamino)benzoate (CAS 82956-09-0) is a chemical compound with the molecular formula C19H17N5O2 and a molecular weight of 347.4 g/mol. IUPAC name: (6-carbamimidoylnaphthalen-2-yl) 3-(diaminomethylideneamino)benzoate. InChIKey: AYRAESWCWGODKE-UHFFFAOYSA-N.
| Molecular formula | C19H17N5O2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (6-carbamimidoylnaphthalen-2-yl) 3-(diaminomethylideneamino)benzoate |
| InChIKey | AYRAESWCWGODKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=C(N)N)C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N |
Computed by PubChem (NCBI)