CAS 83-56-7 appears in our catalog under these names: 1,5-Dihydroxynaphthalene, >95% (HPLC), 1,5-Dihydroxynaphthalene, 1,5–Dihydroxynaphthalene, 1,5-Dihydroxynaphthalene, 98% , 1,5-Naphthalenediol. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 50g, 250mg, 500g, 1000g, 250g, 25g, 100g, 100MG.
Naphthalene-1,5-diol (CAS 83-56-7) is a chemical compound with the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. IUPAC name: naphthalene-1,5-diol. InChIKey: BOKGTLAJQHTOKE-UHFFFAOYSA-N.
| Molecular formula | C10H8O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | naphthalene-1,5-diol |
| InChIKey | BOKGTLAJQHTOKE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2O)C(=C1)O |
Computed by PubChem (NCBI)