CAS 830329-14-1 is the registry number for 2,4-dibromo-6-(2,4,6-tribromophenoxy)-Phenol. Offered by: TRC. Available pack sizes: 100mg.
2,4-dibromo-6-(2,4,6-tribromophenoxy)phenol (CAS 830329-14-1) is a chemical compound with the molecular formula C12H5Br5O2 and a molecular weight of 580.7 g/mol. IUPAC name: 2,4-dibromo-6-(2,4,6-tribromophenoxy)phenol. InChIKey: LFDCJPLJOASSAZ-UHFFFAOYSA-N.
| Molecular formula | C12H5Br5O2 |
|---|---|
| Molecular weight | 580.7 g/mol |
| IUPAC name | 2,4-dibromo-6-(2,4,6-tribromophenoxy)phenol |
| InChIKey | LFDCJPLJOASSAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC2=C(C=C(C=C2Br)Br)Br)O)Br)Br |
Computed by PubChem (NCBI)