CAS 83058-94-0 appears in our catalog under these names: 5-(Benzo[d]oxazol-2-yl)-1,3,4-oxadiazol-2-ol, 97%, Terrecyclic Acid, Terrecyclic Acid. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, Get quote.
(1S,5R,6R,9R)-11,11-dimethyl-2-methylidene-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid (CAS 83058-94-0) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: (1S,5R,6R,9R)-11,11-dimethyl-2-methylidene-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid. InChIKey: SMAWCSOVJJHIOI-JNIYBQFBSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (1S,5R,6R,9R)-11,11-dimethyl-2-methylidene-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid |
| InChIKey | SMAWCSOVJJHIOI-JNIYBQFBSA-N |
| SMILES | CC1(C[C@@]23[C@@H](CC[C@@H]1[C@H]2CC(=O)C3=C)C(=O)O)C |
Computed by PubChem (NCBI)