CAS 83121-18-0 appears in our catalog under these names: Teflubenzuron, Teflubenzuron, >95% (HPLC), Teflubenzuron 100 µg/mL in Methanol, Teflubenzuron 1000 µg/mL in Acetonitrile, TEFLUBENZURON PESTANAL, 250. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: on request, 1g, 250mg, 1ml, 100g, 25g, 5g, 250g.
N-[(3,5-dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide (CAS 83121-18-0) is a chemical compound with the molecular formula C14H6Cl2F4N2O2 and a molecular weight of 381.1 g/mol. IUPAC name: N-[(3,5-dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide. InChIKey: CJDWRQLODFKPEL-UHFFFAOYSA-N.
| Molecular formula | C14H6Cl2F4N2O2 |
|---|---|
| Molecular weight | 381.1 g/mol |
| IUPAC name | N-[(3,5-dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide |
| InChIKey | CJDWRQLODFKPEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C(=C2F)Cl)F)Cl)F |
Computed by PubChem (NCBI)