CAS 832114-00-8 appears in our catalog under these names: 3,5–Dimethylisoxazole–4–boronic acid pinacol ester, 3,5-Dimethylisoxazole-4-boronic acid pinacol ester, 97% , 3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoxazole, >98.0%(GC), 3,5-Dimethylisoxazole-4-boronic acid pinacol ester 98%, 3,5-DIMETHYLISOXAZOLE-4-BORONIC ACID PIN. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 500g, 10mM/1mL, 5 g.
3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (CAS 832114-00-8) is a chemical compound with the molecular formula C11H18BNO3 and a molecular weight of 223.08 g/mol. IUPAC name: 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole. InChIKey: CVLHETBAROWASE-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO3 |
|---|---|
| Molecular weight | 223.08 g/mol |
| IUPAC name | 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| InChIKey | CVLHETBAROWASE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(ON=C2C)C |
Computed by PubChem (NCBI)