CAS 832142-14-0 appears in our catalog under these names: 2-(1-((Methylsulfonyl)oxy)cyclopropyl)acetic acid, 95%, 2–(1–((Methylsulfonyl)oxy)cyclopropyl)acetic acid, 2-(1-((Methylsulfonyl)oxy)cyclopropyl)acetic acid 97%, 2-(1-((Methylsulfonyl)oxy)cyclopropyl)acetic acid, 97%, 97%, 2-(1-((Methylsulfonyl)oxy)cyclopropyl)acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg, 5g.
2-(1-methylsulfonyloxycyclopropyl)acetic acid (CAS 832142-14-0) is a chemical compound with the molecular formula C6H10O5S and a molecular weight of 194.21 g/mol. IUPAC name: 2-(1-methylsulfonyloxycyclopropyl)acetic acid. InChIKey: JBTKTZMLGKJGPH-UHFFFAOYSA-N.
| Molecular formula | C6H10O5S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-(1-methylsulfonyloxycyclopropyl)acetic acid |
| InChIKey | JBTKTZMLGKJGPH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1(CC1)CC(=O)O |
Computed by PubChem (NCBI)