CAS 832674-02-9 is the registry number for 2-Bromo-4-((2,4-dichlorobenzyl)oxy)-5-ethoxybenzaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxybenzaldehyde (CAS 832674-02-9) is a chemical compound with the molecular formula C16H13BrCl2O3 and a molecular weight of 404.1 g/mol. IUPAC name: 2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxybenzaldehyde. InChIKey: WBHCNMNEHJXDDX-UHFFFAOYSA-N.
| Molecular formula | C16H13BrCl2O3 |
|---|---|
| Molecular weight | 404.1 g/mol |
| IUPAC name | 2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxybenzaldehyde |
| InChIKey | WBHCNMNEHJXDDX-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C=O)Br)OCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)