CAS 832737-23-2 is the registry number for 3-((2,4-Dimethylphenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-[(2,4-dimethylphenoxy)methyl]benzoic acid (CAS 832737-23-2) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 3-[(2,4-dimethylphenoxy)methyl]benzoic acid. InChIKey: MNKAPIULKYVOQG-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 3-[(2,4-dimethylphenoxy)methyl]benzoic acid |
| InChIKey | MNKAPIULKYVOQG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=CC(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)