Products 832737-23-2

CAS 832737-23-2 is the registry number for 3-((2,4-Dimethylphenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

3-[(2,4-dimethylphenoxy)methyl]benzoic acid (CAS 832737-23-2) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 3-[(2,4-dimethylphenoxy)methyl]benzoic acid. InChIKey: MNKAPIULKYVOQG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O3
Molecular weight256.30 g/mol
IUPAC name3-[(2,4-dimethylphenoxy)methyl]benzoic acid
InChIKeyMNKAPIULKYVOQG-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)OCC2=CC(=CC=C2)C(=O)O)C

Computed by PubChem (NCBI)