CAS 832737-94-7 is the registry number for 1-(3,4-Dichlorophenyl)-4,4-difluorobutane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3,4-dichlorophenyl)-4,4-difluorobutane-1,3-dione (CAS 832737-94-7) is a chemical compound with the molecular formula C10H6Cl2F2O2 and a molecular weight of 267.05 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-4,4-difluorobutane-1,3-dione. InChIKey: XAQWTATWWPFPLW-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2F2O2 |
|---|---|
| Molecular weight | 267.05 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-4,4-difluorobutane-1,3-dione |
| InChIKey | XAQWTATWWPFPLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CC(=O)C(F)F)Cl)Cl |
Computed by PubChem (NCBI)