CAS 832739-78-3 is the registry number for 5-(Pentachlorophenoxymethyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxylic acid (CAS 832739-78-3) is a chemical compound with the molecular formula C12H5Cl5O4 and a molecular weight of 390.4 g/mol. IUPAC name: 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxylic acid. InChIKey: HIMUWSIFPIZKES-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5O4 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | HIMUWSIFPIZKES-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)COC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)