Products 832739-78-3

CAS 832739-78-3 is the registry number for 5-(Pentachlorophenoxymethyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxylic acid (CAS 832739-78-3) is a chemical compound with the molecular formula C12H5Cl5O4 and a molecular weight of 390.4 g/mol. IUPAC name: 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxylic acid. InChIKey: HIMUWSIFPIZKES-UHFFFAOYSA-N.

Identity
Molecular formulaC12H5Cl5O4
Molecular weight390.4 g/mol
IUPAC name5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxylic acid
InChIKeyHIMUWSIFPIZKES-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)O)COC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl

Computed by PubChem (NCBI)