CAS 832740-18-8 is the registry number for 2-(3-(4,5-Dichloro-6-oxo-1,6-dihydropyridazin-1-yl)adamantan-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[3-(4,5-dichloro-6-oxopyridazin-1-yl)-1-adamantyl]acetic acid (CAS 832740-18-8) is a chemical compound with the molecular formula C16H18Cl2N2O3 and a molecular weight of 357.2 g/mol. IUPAC name: 2-[3-(4,5-dichloro-6-oxopyridazin-1-yl)-1-adamantyl]acetic acid. InChIKey: DXOXDTGEXXVREU-UHFFFAOYSA-N.
| Molecular formula | C16H18Cl2N2O3 |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | 2-[3-(4,5-dichloro-6-oxopyridazin-1-yl)-1-adamantyl]acetic acid |
| InChIKey | DXOXDTGEXXVREU-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N4C(=O)C(=C(C=N4)Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)