CAS 832740-42-8 is the registry number for 5-(2,4-Difluorophenoxymethyl)furan-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylic acid (CAS 832740-42-8) is a chemical compound with the molecular formula C12H8F2O4 and a molecular weight of 254.19 g/mol. IUPAC name: 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylic acid. InChIKey: LANXWLNRDPXBLQ-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O4 |
|---|---|
| Molecular weight | 254.19 g/mol |
| IUPAC name | 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | LANXWLNRDPXBLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)OCC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)