Products 832740-42-8

CAS 832740-42-8 is the registry number for 5-(2,4-Difluorophenoxymethyl)furan-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylic acid (CAS 832740-42-8) is a chemical compound with the molecular formula C12H8F2O4 and a molecular weight of 254.19 g/mol. IUPAC name: 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylic acid. InChIKey: LANXWLNRDPXBLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8F2O4
Molecular weight254.19 g/mol
IUPAC name5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylic acid
InChIKeyLANXWLNRDPXBLQ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)OCC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)