CAS 832746-77-7 is the registry number for 4-(Difluoromethyl)-3-methyl-1-phenyl-1H,6H,7H-pyrazolo(3,4-b)pyridin-6-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(difluoromethyl)-3-methyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one (CAS 832746-77-7) is a chemical compound with the molecular formula C14H11F2N3O and a molecular weight of 275.25 g/mol. IUPAC name: 4-(difluoromethyl)-3-methyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one. InChIKey: REZVQNWKCCUWQS-UHFFFAOYSA-N.
| Molecular formula | C14H11F2N3O |
|---|---|
| Molecular weight | 275.25 g/mol |
| IUPAC name | 4-(difluoromethyl)-3-methyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| InChIKey | REZVQNWKCCUWQS-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=O)N2)C(F)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)