CAS 83283-35-6 is the registry number for H-Pro-OtBu · dibenzenesulfonimide. Offered by: Creative Peptides. Available pack sizes: 1g, 5g, 25g.
N-(benzenesulfonyl)benzenesulfonamide;tert-butyl (2S)-pyrrolidine-2-carboxylate (CAS 83283-35-6) is a chemical compound with the molecular formula C21H28N2O6S2 and a molecular weight of 468.6 g/mol. IUPAC name: N-(benzenesulfonyl)benzenesulfonamide;tert-butyl (2S)-pyrrolidine-2-carboxylate. InChIKey: QWCDJOBXFKHRJN-ZLTKDMPESA-N.
| Molecular formula | C21H28N2O6S2 |
|---|---|
| Molecular weight | 468.6 g/mol |
| IUPAC name | N-(benzenesulfonyl)benzenesulfonamide;tert-butyl (2S)-pyrrolidine-2-carboxylate |
| InChIKey | QWCDJOBXFKHRJN-ZLTKDMPESA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1.C1=CC=C(C=C1)S(=O)(=O)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)