CAS 83310-97-8 appears in our catalog under these names: 3-(Perfluorobutyl)propanol, 95%, 4,4,5,5,6,6,7,7,7-Nonafluoroheptan-1-ol, >95% (GC), 1H,1H,2H,2H,3H,3H-Perfluoroheptanol, 4,4,5,5,6,6,7,7,7-Nonafluoro-1-heptanol, >98.0%(GC), 4,4,5,5,6,6,7,7,7-Nonafluoroheptan-1-ol 95%. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 500mg, 100mg, 100g.
4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-ol (CAS 83310-97-8) is a chemical compound with the molecular formula C7H7F9O and a molecular weight of 278.12 g/mol. IUPAC name: 4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-ol. InChIKey: OVBNEUIFHDEQHD-UHFFFAOYSA-N.
| Molecular formula | C7H7F9O |
|---|---|
| Molecular weight | 278.12 g/mol |
| IUPAC name | 4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-ol |
| InChIKey | OVBNEUIFHDEQHD-UHFFFAOYSA-N |
| SMILES | C(CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)CO |
Computed by PubChem (NCBI)