CAS 83314-78-7 appears in our catalog under these names: Propranolol EP Impurity B, Propranolol Impurity 2(Propranolol EP Impurity B), 1,1'-((1-Methylethyl)imino)bis(3-(1-naphthalenyloxy)-2-propanol, >95% (HPLC), 1,1'-((1-Methylethyl)imino)bis(3-(1-naphthalenyloxy)-2-propanol hydrochloride, Propranolol EP Impurity B HCl. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
1-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-3-naphthalen-1-yloxypropan-2-ol (CAS 83314-78-7) is a chemical compound with the molecular formula C29H33NO4 and a molecular weight of 459.6 g/mol. IUPAC name: 1-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-3-naphthalen-1-yloxypropan-2-ol. InChIKey: MKZHJJQCUIZEDE-UHFFFAOYSA-N.
| Molecular formula | C29H33NO4 |
|---|---|
| Molecular weight | 459.6 g/mol |
| IUPAC name | 1-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-3-naphthalen-1-yloxypropan-2-ol |
| InChIKey | MKZHJJQCUIZEDE-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC(COC1=CC=CC2=CC=CC=C21)O)CC(COC3=CC=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)