CAS 83315-74-6 is the registry number for p–AZIDOMETHYLPHENYLTRIMETHOXYSILANE. Offered by: GLPBio. Available pack sizes: 1g.
[4-(azidomethyl)phenyl]-trimethoxysilane (CAS 83315-74-6) is a chemical compound with the molecular formula C10H15N3O3Si and a molecular weight of 253.33 g/mol. IUPAC name: [4-(azidomethyl)phenyl]-trimethoxysilane. InChIKey: SKHMGPZIVVGDIM-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O3Si |
|---|---|
| Molecular weight | 253.33 g/mol |
| IUPAC name | [4-(azidomethyl)phenyl]-trimethoxysilane |
| InChIKey | SKHMGPZIVVGDIM-UHFFFAOYSA-N |
| SMILES | CO[Si](C1=CC=C(C=C1)CN=[N+]=[N-])(OC)OC |
Computed by PubChem (NCBI)