CAS 83373-60-8 appears in our catalog under these names: Carbonodithioic Acid O-(Octahydro-4,7-methano-1H-inden-5-yl) Ester Potassium Salt, D609/ 99.75% (existing batch purity), D609, O-Tricyclo(5.2.1.02,6)dec-9-yl dithiocarbonate potassium salt, D609, Potassium Salt 1PC X 5MG. Offered by: TRC, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 5g, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso).
Potassium 8-tricyclo[5.2.1.02,6]decanyloxymethanedithioate (CAS 83373-60-8) is a chemical compound with the molecular formula C11H15KOS2 and a molecular weight of 266.5 g/mol. IUPAC name: potassium 8-tricyclo[5.2.1.02,6]decanyloxymethanedithioate. InChIKey: IGULCCCBGBDZKQ-UHFFFAOYSA-M.
| Molecular formula | C11H15KOS2 |
|---|---|
| Molecular weight | 266.5 g/mol |
| IUPAC name | potassium 8-tricyclo[5.2.1.02,6]decanyloxymethanedithioate |
| InChIKey | IGULCCCBGBDZKQ-UHFFFAOYSA-M |
| SMILES | C1CC2C(C1)C3CC2CC3OC(=S)[S-].[K+] |
Computed by PubChem (NCBI)