CAS 834-89-9 appears in our catalog under these names: 2,3,5,6-Tetrafluorobiphenyl, 95+%, 2,3,5,6-tetrafluoro-1,1'-biphenyl, ≥97%, ≥97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g.
1,2,4,5-tetrafluoro-3-phenylbenzene (CAS 834-89-9) is a chemical compound with the molecular formula C12H6F4 and a molecular weight of 226.17 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-phenylbenzene. InChIKey: LRKGVNRCLRPAPR-UHFFFAOYSA-N.
| Molecular formula | C12H6F4 |
|---|---|
| Molecular weight | 226.17 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-phenylbenzene |
| InChIKey | LRKGVNRCLRPAPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)