Products 83405-71-4
CAS 83405-71-4 appears in our catalog under these names: 3–(tert–Butyl)–1H–pyrazole–5–carboxylic acid, 5- tert -Butyl-2 H -pyrazole-3-carboxylic acid, 95%, 3-(tert-Butyl)-1H-pyrazole-5-carboxylic acid, 95%, 3-tert-Butyl-1H-pyrazole-5-carboxylic acid, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 100mg.
5-tert-butyl-1H-pyrazole-3-carboxylic acid (CAS 83405-71-4) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: 5-tert-butyl-1H-pyrazole-3-carboxylic acid. InChIKey: RQRWZFJMPKHYIC-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 5-tert-butyl-1H-pyrazole-3-carboxylic acid |
| InChIKey | RQRWZFJMPKHYIC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NN1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-tert-butyl-1H-pyrazole-5-carboxylic acid, 5-tert-butyl-1H-pyrazole-3-carboxylic acid, 5-tert-Butyl-2H-pyrazole-3-carboxylic acid, 3-(tert-Butyl)-1H-pyrazole-5-carboxylic acid, 1H-Pyrazole-3-carboxylic acid, 5-(1,1-dimethylethyl)-, 5-tert-butyl-2 h-pyrazole-3-carboxylic acid, 5-(tert-Butyl)-1H-pyrazole-3-carboxylic acid, 1H-pyrazole-5-carboxylic acid, 3-(1,1-dimethylethyl)-, 3-(tert-butyl)pyrazole-5-carboxylic acid, ChemDiv3_014364