CAS 83418-48-8 appears in our catalog under these names: D(+)-2-Phosphoglyceric acid sodium hydrate, D(+)2-PHOSPHOGLYCERIC ACID SODIUM SALT &. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 100mg, 1G, 50MG.
Sodium (2R)-3-hydroxy-2-phosphonooxypropanoate (CAS 83418-48-8) is a chemical compound with the molecular formula C3H6NaO7P and a molecular weight of 208.04 g/mol. IUPAC name: sodium (2R)-3-hydroxy-2-phosphonooxypropanoate. InChIKey: FDCUSZSRIXDPHE-HSHFZTNMSA-M.
| Molecular formula | C3H6NaO7P |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | sodium (2R)-3-hydroxy-2-phosphonooxypropanoate |
| InChIKey | FDCUSZSRIXDPHE-HSHFZTNMSA-M |
| SMILES | C([C@H](C(=O)[O-])OP(=O)(O)O)O.[Na+] |
Computed by PubChem (NCBI)