CAS 83486-43-5 appears in our catalog under these names: Bis(2,2,2-trifluoroethoxy)methanethione, 95%, Bis(2,2,2-trifluoroethoxy)methanethione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Bis(2,2,2-trifluoroethoxy)methanethione (CAS 83486-43-5) is a chemical compound with the molecular formula C5H4F6O2S and a molecular weight of 242.14 g/mol. IUPAC name: bis(2,2,2-trifluoroethoxy)methanethione. InChIKey: KLHBTFFZKRVEHH-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O2S |
|---|---|
| Molecular weight | 242.14 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethoxy)methanethione |
| InChIKey | KLHBTFFZKRVEHH-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(=S)OCC(F)(F)F |
Computed by PubChem (NCBI)