CAS 834913-94-9 appears in our catalog under these names: 3-[(4-Chloro-3-methylphenoxy)methyl]-4-methoxybenzaldehyde, 95%, 3-((4-Chloro-3-methylphenoxy)methyl)-4-methoxybenzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzaldehyde (CAS 834913-94-9) is a chemical compound with the molecular formula C16H15ClO3 and a molecular weight of 290.74 g/mol. IUPAC name: 3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzaldehyde. InChIKey: RPEKEFDWEPTYRE-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO3 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | 3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzaldehyde |
| InChIKey | RPEKEFDWEPTYRE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC2=C(C=CC(=C2)C=O)OC)Cl |
Computed by PubChem (NCBI)