CAS 83493-84-9 is the registry number for 2–(4–isopropylphenyl)–2–methylpropan–1–ol. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 500mg, 5g.
2-methyl-2-(4-propan-2-ylphenyl)propan-1-ol (CAS 83493-84-9) is a chemical compound with the molecular formula C13H20O and a molecular weight of 192.30 g/mol. IUPAC name: 2-methyl-2-(4-propan-2-ylphenyl)propan-1-ol. InChIKey: VTASMXXAEGVHRD-UHFFFAOYSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | 2-methyl-2-(4-propan-2-ylphenyl)propan-1-ol |
| InChIKey | VTASMXXAEGVHRD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(C)(C)CO |
Computed by PubChem (NCBI)