CAS 83575-37-5 appears in our catalog under these names: Nalpha-cbz-l-citrulline-p-nitroanilide, 95%, Nalpha-CBZ-L-Citrulline-p-nitroanilide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
Benzyl N-[(2S)-5-(carbamoylamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate (CAS 83575-37-5) is a chemical compound with the molecular formula C20H23N5O6 and a molecular weight of 429.4 g/mol. IUPAC name: benzyl N-[(2S)-5-(carbamoylamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate. InChIKey: HEAHCFJXSKVWFQ-KRWDZBQOSA-N.
| Molecular formula | C20H23N5O6 |
|---|---|
| Molecular weight | 429.4 g/mol |
| IUPAC name | benzyl N-[(2S)-5-(carbamoylamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate |
| InChIKey | HEAHCFJXSKVWFQ-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCNC(=O)N)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)