Products 83610-65-5
CAS 83610-65-5 is the registry number for Benzyl L-leucyl-L-prolinate 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-1-[(2S)-2-amino-4-methylpentanoyl]pyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid (CAS 83610-65-5) is a chemical compound with the molecular formula C20H27F3N2O5 and a molecular weight of 432.4 g/mol. IUPAC name: benzyl (2S)-1-[(2S)-2-amino-4-methylpentanoyl]pyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: WBFZRSPKPXBCRT-MOGJOVFKSA-N.
| Molecular formula | C20H27F3N2O5 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | benzyl (2S)-1-[(2S)-2-amino-4-methylpentanoyl]pyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid |
| InChIKey | WBFZRSPKPXBCRT-MOGJOVFKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N1CCC[C@H]1C(=O)OCC2=CC=CC=C2)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)