CAS 836640-15-4 appears in our catalog under these names: PARP1-IN-8 / 98.26% (existing batch purity), PARP1–IN–8, N-(3-Chlorophenyl)-3-(1-oxo-4-phenylphthalazin-2(1H)-yl)propanamide, 98%, 98%, PARP1-IN-8, 99.29%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
N-(3-chlorophenyl)-3-(1-oxo-4-phenylphthalazin-2-yl)propanamide (CAS 836640-15-4) is a chemical compound with the molecular formula C23H18ClN3O2 and a molecular weight of 403.9 g/mol. IUPAC name: N-(3-chlorophenyl)-3-(1-oxo-4-phenylphthalazin-2-yl)propanamide. InChIKey: BOYHFRMRSLOWLL-UHFFFAOYSA-N.
| Molecular formula | C23H18ClN3O2 |
|---|---|
| Molecular weight | 403.9 g/mol |
| IUPAC name | N-(3-chlorophenyl)-3-(1-oxo-4-phenylphthalazin-2-yl)propanamide |
| InChIKey | BOYHFRMRSLOWLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=O)C3=CC=CC=C32)CCC(=O)NC4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)