Products 836662-18-1

CAS 836662-18-1 is the registry number for 2-(5-Bromo-4-formyl-2-methoxyphenoxy)ethyl acetate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(5-bromo-4-formyl-2-methoxyphenoxy)ethyl acetate (CAS 836662-18-1) is a chemical compound with the molecular formula C12H13BrO5 and a molecular weight of 317.13 g/mol. IUPAC name: 2-(5-bromo-4-formyl-2-methoxyphenoxy)ethyl acetate. InChIKey: SEZGOHAUZNZUNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13BrO5
Molecular weight317.13 g/mol
IUPAC name2-(5-bromo-4-formyl-2-methoxyphenoxy)ethyl acetate
InChIKeySEZGOHAUZNZUNZ-UHFFFAOYSA-N
SMILESCC(=O)OCCOC1=C(C=C(C(=C1)Br)C=O)OC

Computed by PubChem (NCBI)