Products 836671-12-6
CAS 836671-12-6 is the registry number for JNJ-4929821. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(4-fluorophenyl)methyl]-N-(1H-1,2,4-triazol-5-ylmethyl)thiophene-2-sulfonamide (CAS 836671-12-6) is a chemical compound with the molecular formula C14H13FN4O2S2 and a molecular weight of 352.4 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-N-(1H-1,2,4-triazol-5-ylmethyl)thiophene-2-sulfonamide. InChIKey: UGVZRLMKBSBNEC-UHFFFAOYSA-N.
| Molecular formula | C14H13FN4O2S2 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-N-(1H-1,2,4-triazol-5-ylmethyl)thiophene-2-sulfonamide |
| InChIKey | UGVZRLMKBSBNEC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)S(=O)(=O)N(CC2=CC=C(C=C2)F)CC3=NC=NN3 |
Computed by PubChem (NCBI)