CAS 836682-64-5 is the registry number for p38 Kinase-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(5-amino-4-benzoylpyrazol-1-yl)-N-cyclopropyl-4-methylbenzamide (CAS 836682-64-5) is a chemical compound with the molecular formula C21H20N4O2 and a molecular weight of 360.4 g/mol. IUPAC name: 3-(5-amino-4-benzoylpyrazol-1-yl)-N-cyclopropyl-4-methylbenzamide. InChIKey: YKRHGHVJNYCHEN-UHFFFAOYSA-N.
| Molecular formula | C21H20N4O2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 3-(5-amino-4-benzoylpyrazol-1-yl)-N-cyclopropyl-4-methylbenzamide |
| InChIKey | YKRHGHVJNYCHEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2CC2)N3C(=C(C=N3)C(=O)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)