CAS 836683-15-9 appears in our catalog under these names: Acumapimod, 95%, Acumapimod/ 98%, Acumapimod, Acumapimod 98+%, Acumapimod, 98+%, 98+%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
3-[5-amino-4-(3-cyanobenzoyl)pyrazol-1-yl]-N-cyclopropyl-4-methylbenzamide (CAS 836683-15-9) is a chemical compound with the molecular formula C22H19N5O2 and a molecular weight of 385.4 g/mol. IUPAC name: 3-[5-amino-4-(3-cyanobenzoyl)pyrazol-1-yl]-N-cyclopropyl-4-methylbenzamide. InChIKey: VGUSQKZDZHAAEE-UHFFFAOYSA-N.
| Molecular formula | C22H19N5O2 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 3-[5-amino-4-(3-cyanobenzoyl)pyrazol-1-yl]-N-cyclopropyl-4-methylbenzamide |
| InChIKey | VGUSQKZDZHAAEE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2CC2)N3C(=C(C=N3)C(=O)C4=CC=CC(=C4)C#N)N |
Computed by PubChem (NCBI)