CAS 83683-96-9 is the registry number for Phenyl Acetate-13C2. Offered by: TRC. Available pack sizes: 1g.
Phenyl acetate (CAS 83683-96-9) is a chemical compound with the molecular formula C8H8O2 and a molecular weight of 138.13 g/mol. IUPAC name: phenyl acetate. InChIKey: IPBVNPXQWQGGJP-SPBYTNOZSA-N.
| Molecular formula | C8H8O2 |
|---|---|
| Molecular weight | 138.13 g/mol |
| IUPAC name | phenyl acetate |
| InChIKey | IPBVNPXQWQGGJP-SPBYTNOZSA-N |
| SMILES | [13CH3][13C](=O)OC1=CC=CC=C1 |
Computed by PubChem (NCBI)