CAS 837-08-1 appears in our catalog under these names: 2,4'-Bisphenol A, >95% (HPLC), 2,4′–Bisphenol A, 2,4′-Bisphenol A 98%, 2-(2-(4-Hydroxyphenyl)propan-2-yl)phenol, 95%, 95%, 2-(2-(4-Hydroxyphenyl)propan-2-yl)phenol, 98%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 5mg, 1g.
2-[2-(4-hydroxyphenyl)propan-2-yl]phenol (CAS 837-08-1) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: 2-[2-(4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: MLCQXUZZAXKTSG-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 2-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | MLCQXUZZAXKTSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)