CAS 837-91-2 is the registry number for Deschloro-fluoro-hydrochlorothiazide. Offered by: TRC. Available pack sizes: 100mg.
6-fluoro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 837-91-2) is a chemical compound with the molecular formula C7H8FN3O4S2 and a molecular weight of 281.3 g/mol. IUPAC name: 6-fluoro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: QBFRPGRSZWPABV-UHFFFAOYSA-N.
| Molecular formula | C7H8FN3O4S2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 6-fluoro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | QBFRPGRSZWPABV-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)F |
Computed by PubChem (NCBI)